About 8,9-dihydroxy-4-oxatricyclo[5.2.1.02,6]decan-3-one
8,9-dihydroxy-4-oxatricyclo[5.2.1.02,6]decan-3-one (PubChem CID 22034559) has the molecular formula C9H12O4
and a molecular weight of 184.19 g/mol. Its IUPAC name is 8,9-dihydroxy-4-oxatricyclo[5.2.1.02,6]decan-3-one.
Molecular Properties
| Compound Name | 8,9-dihydroxy-4-oxatricyclo[5.2.1.02,6]decan-3-one |
| PubChem CID | 22034559 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 8,9-dihydroxy-4-oxatricyclo[5.2.1.02,6]decan-3-one |
| SMILES | O=C1OCC2C3CC(C(O)C3O)C12 |
| InChI | InChI=1S/C9H12O4/c10-7-3-1-4(8(7)11)6-5(3)2-13-9(6)12/h3-8,10-11H,1-2H2 |
| InChIKey | INSPFFCMFKEJPI-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8,9-dihydroxy-4-oxatricyclo[5.2.1.02,6]decan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,9-dihydroxy-4-oxatricyclo[5.2.1.02,6]decan-3-one?
The IUPAC name of 8,9-dihydroxy-4-oxatricyclo[5.2.1.02,6]decan-3-one (CID 22034559) is 8,9-dihydroxy-4-oxatricyclo[5.2.1.02,6]decan-3-one.
What is the SMILES notation for 8,9-dihydroxy-4-oxatricyclo[5.2.1.02,6]decan-3-one?
The canonical SMILES for 8,9-dihydroxy-4-oxatricyclo[5.2.1.02,6]decan-3-one is O=C1OCC2C3CC(C(O)C3O)C12.
What is the InChIKey of 8,9-dihydroxy-4-oxatricyclo[5.2.1.02,6]decan-3-one?
The InChIKey is INSPFFCMFKEJPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O4/c10-7-3-1-4(8(7)11)6-5(3)2-13-9(6)12/h3-8,10-11H,1-2H2.
What are the key properties of 8,9-dihydroxy-4-oxatricyclo[5.2.1.02,6]decan-3-one?
8,9-dihydroxy-4-oxatricyclo[5.2.1.02,6]decan-3-one has a molecular weight of 184.19 g/mol, XLogP of -0.85, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8,9-dihydroxy-4-oxatricyclo[5.2.1.02,6]decan-3-one is sourced from PubChem (CID 22034559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).