About prop-2-enyl 2-cyclohexylacetate
prop-2-enyl 2-cyclohexylacetate (PubChem CID 22034852) has the molecular formula C11H18O2
and a molecular weight of 182.26 g/mol. Its IUPAC name is prop-2-enyl 2-cyclohexylacetate.
Molecular Properties
| Compound Name | prop-2-enyl 2-cyclohexylacetate |
| PubChem CID | 22034852 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | prop-2-enyl 2-cyclohexylacetate |
| SMILES | C=CCOC(=O)CC1CCCCC1 |
| InChI | InChI=1S/C11H18O2/c1-2-8-13-11(12)9-10-6-4-3-5-7-10/h2,10H,1,3-9H2 |
| InChIKey | UECFOOSFSUDPOR-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl 2-cyclohexylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl 2-cyclohexylacetate?
The IUPAC name of prop-2-enyl 2-cyclohexylacetate (CID 22034852) is prop-2-enyl 2-cyclohexylacetate.
What is the SMILES notation for prop-2-enyl 2-cyclohexylacetate?
The canonical SMILES for prop-2-enyl 2-cyclohexylacetate is C=CCOC(=O)CC1CCCCC1.
What is the InChIKey of prop-2-enyl 2-cyclohexylacetate?
The InChIKey is UECFOOSFSUDPOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O2/c1-2-8-13-11(12)9-10-6-4-3-5-7-10/h2,10H,1,3-9H2.
What are the key properties of prop-2-enyl 2-cyclohexylacetate?
prop-2-enyl 2-cyclohexylacetate has a molecular weight of 182.26 g/mol, XLogP of 2.69, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl 2-cyclohexylacetate is sourced from PubChem (CID 22034852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).