C11H21NO — CID 22034967
3,3,4,4-tetramethyl-2-methylidenehexanamide (PubChem CID 22034967) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is 3,3,4,4-tetramethyl-2-methylidenehexanamide.
| Compound Name | 3,3,4,4-tetramethyl-2-methylidenehexanamide |
|---|---|
| PubChem CID | 22034967 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 3,3,4,4-tetramethyl-2-methylidenehexanamide |
| SMILES | C=C(C(N)=O)C(C)(C)C(C)(C)CC |
| InChI | InChI=1S/C11H21NO/c1-7-10(3,4)11(5,6)8(2)9(12)13/h2,7H2,1,3-6H3,(H2,12,13) |
| InChIKey | ISGYDNVAUOTXOK-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|