About 1,1-diethoxyethane;N-(2,2-dimethoxyethyl)-2-methylpropanamide
1,1-diethoxyethane;N-(2,2-dimethoxyethyl)-2-methylpropanamide (PubChem CID 22034975) has the molecular formula C14H31NO5
and a molecular weight of 293.40 g/mol. Its IUPAC name is 1,1-diethoxyethane;N-(2,2-dimethoxyethyl)-2-methylpropanamide.
Molecular Properties
| Compound Name | 1,1-diethoxyethane;N-(2,2-dimethoxyethyl)-2-methylpropanamide |
| PubChem CID | 22034975 |
| Molecular Formula | C14H31NO5 |
| Molecular Weight | 293.40 g/mol |
| Exact Mass | 293.22 |
| IUPAC Name | 1,1-diethoxyethane;N-(2,2-dimethoxyethyl)-2-methylpropanamide |
| SMILES | CCOC(C)OCC.COC(CNC(=O)C(C)C)OC |
| InChI | InChI=1S/C8H17NO3.C6H14O2/c1-6(2)8(10)9-5-7(11-3)12-4;1-4-7-6(3)8-5-2/h6-7H,5H2,1-4H3,(H,9,10);6H,4-5H2,1-3H3 |
| InChIKey | CBLHAYVFRLGLAP-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.40 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,1-diethoxyethane;N-(2,2-dimethoxyethyl)-2-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-diethoxyethane;N-(2,2-dimethoxyethyl)-2-methylpropanamide?
The IUPAC name of 1,1-diethoxyethane;N-(2,2-dimethoxyethyl)-2-methylpropanamide (CID 22034975) is 1,1-diethoxyethane;N-(2,2-dimethoxyethyl)-2-methylpropanamide.
What is the SMILES notation for 1,1-diethoxyethane;N-(2,2-dimethoxyethyl)-2-methylpropanamide?
The canonical SMILES for 1,1-diethoxyethane;N-(2,2-dimethoxyethyl)-2-methylpropanamide is CCOC(C)OCC.COC(CNC(=O)C(C)C)OC.
What is the InChIKey of 1,1-diethoxyethane;N-(2,2-dimethoxyethyl)-2-methylpropanamide?
The InChIKey is CBLHAYVFRLGLAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO3.C6H14O2/c1-6(2)8(10)9-5-7(11-3)12-4;1-4-7-6(3)8-5-2/h6-7H,5H2,1-4H3,(H,9,10);6H,4-5H2,1-3H3.
What are the key properties of 1,1-diethoxyethane;N-(2,2-dimethoxyethyl)-2-methylpropanamide?
1,1-diethoxyethane;N-(2,2-dimethoxyethyl)-2-methylpropanamide has a molecular weight of 293.40 g/mol, XLogP of 1.78, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-diethoxyethane;N-(2,2-dimethoxyethyl)-2-methylpropanamide is sourced from PubChem (CID 22034975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).