About 2-[9-(2-chloroanilino)-3,6-bis(diethylamino)-9H-xanthen-1-yl]benzoic acid
2-[9-(2-chloroanilino)-3,6-bis(diethylamino)-9H-xanthen-1-yl]benzoic acid (PubChem CID 22035395) has the molecular formula C34H36ClN3O3
and a molecular weight of 570.13 g/mol. Its IUPAC name is 2-[9-(2-chloroanilino)-3,6-bis(diethylamino)-9H-xanthen-1-yl]benzoic acid.
Molecular Properties
| Compound Name | 2-[9-(2-chloroanilino)-3,6-bis(diethylamino)-9H-xanthen-1-yl]benzoic acid |
| PubChem CID | 22035395 |
| Molecular Formula | C34H36ClN3O3 |
| Molecular Weight | 570.13 g/mol |
| Exact Mass | 569.24 |
| IUPAC Name | 2-[9-(2-chloroanilino)-3,6-bis(diethylamino)-9H-xanthen-1-yl]benzoic acid |
| SMILES | CCN(CC)c1ccc2c(c1)Oc1cc(N(CC)CC)cc(-c3ccccc3C(=O)O)c1C2Nc1ccccc1Cl |
| InChI | InChI=1S/C34H36ClN3O3/c1-5-37(6-2)22-17-18-26-30(20-22)41-31-21-23(38(7-3)8-4)19-27(24-13-9-10-14-25(24)34(39)40)32(31)33(26)36-29-16-12-11-15-28(29)35/h9-21,33,36H,5-8H2,1-4H3,(H,39,40) |
| InChIKey | OKJNNGVSDGFUBM-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 570.13 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|
Analyze 2-[9-(2-chloroanilino)-3,6-bis(diethylamino)-9H-xanthen-1-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[9-(2-chloroanilino)-3,6-bis(diethylamino)-9H-xanthen-1-yl]benzoic acid?
The IUPAC name of 2-[9-(2-chloroanilino)-3,6-bis(diethylamino)-9H-xanthen-1-yl]benzoic acid (CID 22035395) is 2-[9-(2-chloroanilino)-3,6-bis(diethylamino)-9H-xanthen-1-yl]benzoic acid.
What is the SMILES notation for 2-[9-(2-chloroanilino)-3,6-bis(diethylamino)-9H-xanthen-1-yl]benzoic acid?
The canonical SMILES for 2-[9-(2-chloroanilino)-3,6-bis(diethylamino)-9H-xanthen-1-yl]benzoic acid is CCN(CC)c1ccc2c(c1)Oc1cc(N(CC)CC)cc(-c3ccccc3C(=O)O)c1C2Nc1ccccc1Cl.
What is the InChIKey of 2-[9-(2-chloroanilino)-3,6-bis(diethylamino)-9H-xanthen-1-yl]benzoic acid?
The InChIKey is OKJNNGVSDGFUBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H36ClN3O3/c1-5-37(6-2)22-17-18-26-30(20-22)41-31-21-23(38(7-3)8-4)19-27(24-13-9-10-14-25(24)34(39)40)32(31)33(26)36-29-16-12-11-15-28(29)35/h9-21,33,36H,5-8H2,1-4H3,(H,39,40).
What are the key properties of 2-[9-(2-chloroanilino)-3,6-bis(diethylamino)-9H-xanthen-1-yl]benzoic acid?
2-[9-(2-chloroanilino)-3,6-bis(diethylamino)-9H-xanthen-1-yl]benzoic acid has a molecular weight of 570.13 g/mol, XLogP of 8.70, 10 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[9-(2-chloroanilino)-3,6-bis(diethylamino)-9H-xanthen-1-yl]benzoic acid is sourced from PubChem (CID 22035395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).