About 5-(dimethylamino)-3,3-bis(2-phenyl-1H-indol-3-yl)-2-benzofuran-1-one
5-(dimethylamino)-3,3-bis(2-phenyl-1H-indol-3-yl)-2-benzofuran-1-one (PubChem CID 22035409) has the molecular formula C38H29N3O2
and a molecular weight of 559.67 g/mol. Its IUPAC name is 5-(dimethylamino)-3,3-bis(2-phenyl-1H-indol-3-yl)-2-benzofuran-1-one.
Molecular Properties
| Compound Name | 5-(dimethylamino)-3,3-bis(2-phenyl-1H-indol-3-yl)-2-benzofuran-1-one |
| PubChem CID | 22035409 |
| Molecular Formula | C38H29N3O2 |
| Molecular Weight | 559.67 g/mol |
| Exact Mass | 559.23 |
| IUPAC Name | 5-(dimethylamino)-3,3-bis(2-phenyl-1H-indol-3-yl)-2-benzofuran-1-one |
| SMILES | CN(C)c1ccc2c(c1)C(c1c(-c3ccccc3)[nH]c3ccccc13)(c1c(-c3ccccc3)[nH]c3ccccc13)OC2=O |
| InChI | InChI=1S/C38H29N3O2/c1-41(2)26-21-22-27-30(23-26)38(43-37(27)42,33-28-17-9-11-19-31(28)39-35(33)24-13-5-3-6-14-24)34-29-18-10-12-20-32(29)40-36(34)25-15-7-4-8-16-25/h3-23,39-40H,1-2H3 |
| InChIKey | ZKIANJBTYMAVTC-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 61.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 559.67 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(dimethylamino)-3,3-bis(2-phenyl-1H-indol-3-yl)-2-benzofuran-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(dimethylamino)-3,3-bis(2-phenyl-1H-indol-3-yl)-2-benzofuran-1-one?
The IUPAC name of 5-(dimethylamino)-3,3-bis(2-phenyl-1H-indol-3-yl)-2-benzofuran-1-one (CID 22035409) is 5-(dimethylamino)-3,3-bis(2-phenyl-1H-indol-3-yl)-2-benzofuran-1-one.
What is the SMILES notation for 5-(dimethylamino)-3,3-bis(2-phenyl-1H-indol-3-yl)-2-benzofuran-1-one?
The canonical SMILES for 5-(dimethylamino)-3,3-bis(2-phenyl-1H-indol-3-yl)-2-benzofuran-1-one is CN(C)c1ccc2c(c1)C(c1c(-c3ccccc3)[nH]c3ccccc13)(c1c(-c3ccccc3)[nH]c3ccccc13)OC2=O.
What is the InChIKey of 5-(dimethylamino)-3,3-bis(2-phenyl-1H-indol-3-yl)-2-benzofuran-1-one?
The InChIKey is ZKIANJBTYMAVTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C38H29N3O2/c1-41(2)26-21-22-27-30(23-26)38(43-37(27)42,33-28-17-9-11-19-31(28)39-35(33)24-13-5-3-6-14-24)34-29-18-10-12-20-32(29)40-36(34)25-15-7-4-8-16-25/h3-23,39-40H,1-2H3.
What are the key properties of 5-(dimethylamino)-3,3-bis(2-phenyl-1H-indol-3-yl)-2-benzofuran-1-one?
5-(dimethylamino)-3,3-bis(2-phenyl-1H-indol-3-yl)-2-benzofuran-1-one has a molecular weight of 559.67 g/mol, XLogP of 8.51, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(dimethylamino)-3,3-bis(2-phenyl-1H-indol-3-yl)-2-benzofuran-1-one is sourced from PubChem (CID 22035409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).