C27H28N6O — CID 22035560
2-[4-[bis(2H-benzotriazol-4-yl)methyl]-2,3,3-trimethylpent-4-en-2-yl]phenol (PubChem CID 22035560) has the molecular formula C27H28N6O and a molecular weight of 452.56 g/mol. Its IUPAC name is 2-[4-[bis(2H-benzotriazol-4-yl)methyl]-2,3,3-trimethylpent-4-en-2-yl]phenol.
| Compound Name | 2-[4-[bis(2H-benzotriazol-4-yl)methyl]-2,3,3-trimethylpent-4-en-2-yl]phenol |
|---|---|
| PubChem CID | 22035560 |
| Molecular Formula | C27H28N6O |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | 2-[4-[bis(2H-benzotriazol-4-yl)methyl]-2,3,3-trimethylpent-4-en-2-yl]phenol |
| SMILES | C=C(C(c1cccc2n[nH]nc12)c1cccc2n[nH]nc12)C(C)(C)C(C)(C)c1ccccc1O |
| InChI | InChI=1S/C27H28N6O/c1-16(26(2,3)27(4,5)19-12-6-7-15-22(19)34)23(17-10-8-13-20-24(17)30-32-28-20)18-11-9-14-21-25(18)31-33-29-21/h6-15,23,34H,1H2,2-5H3,(H,28,30,32)(H,29,31,33) |
| InChIKey | LYVZHNATXUMRML-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 103.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|