About N,N-diethylethanamine;2-methoxy-2-methylpropane
N,N-diethylethanamine;2-methoxy-2-methylpropane (PubChem CID 22035616) has the molecular formula C11H27NO
and a molecular weight of 189.34 g/mol. Its IUPAC name is N,N-diethylethanamine;2-methoxy-2-methylpropane.
Molecular Properties
| Compound Name | N,N-diethylethanamine;2-methoxy-2-methylpropane |
| PubChem CID | 22035616 |
| Molecular Formula | C11H27NO |
| Molecular Weight | 189.34 g/mol |
| Exact Mass | 189.21 |
| IUPAC Name | N,N-diethylethanamine;2-methoxy-2-methylpropane |
| SMILES | CCN(CC)CC.COC(C)(C)C |
| InChI | InChI=1S/C6H15N.C5H12O/c1-4-7(5-2)6-3;1-5(2,3)6-4/h4-6H2,1-3H3;1-4H3 |
| InChIKey | KWIKQZPLNQHABK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.34 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-diethylethanamine;2-methoxy-2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylethanamine;2-methoxy-2-methylpropane?
The IUPAC name of N,N-diethylethanamine;2-methoxy-2-methylpropane (CID 22035616) is N,N-diethylethanamine;2-methoxy-2-methylpropane.
What is the SMILES notation for N,N-diethylethanamine;2-methoxy-2-methylpropane?
The canonical SMILES for N,N-diethylethanamine;2-methoxy-2-methylpropane is CCN(CC)CC.COC(C)(C)C.
What is the InChIKey of N,N-diethylethanamine;2-methoxy-2-methylpropane?
The InChIKey is KWIKQZPLNQHABK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.C5H12O/c1-4-7(5-2)6-3;1-5(2,3)6-4/h4-6H2,1-3H3;1-4H3.
What are the key properties of N,N-diethylethanamine;2-methoxy-2-methylpropane?
N,N-diethylethanamine;2-methoxy-2-methylpropane has a molecular weight of 189.34 g/mol, XLogP of 2.78, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylethanamine;2-methoxy-2-methylpropane is sourced from PubChem (CID 22035616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).