C16H22N2O6 — CID 22036054
2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]pyridine-4-carboxylic acid (PubChem CID 22036054) has the molecular formula C16H22N2O6 and a molecular weight of 338.36 g/mol. Its IUPAC name is 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]pyridine-4-carboxylic acid.
| Compound Name | 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 22036054 |
| Molecular Formula | C16H22N2O6 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]pyridine-4-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)c1cc(C(=O)O)ccn1 |
| InChI | InChI=1S/C16H22N2O6/c1-15(2,3)23-13(21)18(14(22)24-16(4,5)6)11-9-10(12(19)20)7-8-17-11/h7-9H,1-6H3,(H,19,20) |
| InChIKey | ICMJGDZGUQSBEN-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |