About 1,11-diazatricyclo[7.4.1.05,14]tetradeca-5(14),6,8-triene
1,11-diazatricyclo[7.4.1.05,14]tetradeca-5(14),6,8-triene (PubChem CID 22036724) has the molecular formula C12H16N2
and a molecular weight of 188.27 g/mol. Its IUPAC name is 1,11-diazatricyclo[7.4.1.05,14]tetradeca-5(14),6,8-triene.
Analyze 1,11-diazatricyclo[7.4.1.05,14]tetradeca-5(14),6,8-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,11-diazatricyclo[7.4.1.05,14]tetradeca-5(14),6,8-triene?
The IUPAC name of 1,11-diazatricyclo[7.4.1.05,14]tetradeca-5(14),6,8-triene (CID 22036724) is 1,11-diazatricyclo[7.4.1.05,14]tetradeca-5(14),6,8-triene.
What is the SMILES notation for 1,11-diazatricyclo[7.4.1.05,14]tetradeca-5(14),6,8-triene?
The canonical SMILES for 1,11-diazatricyclo[7.4.1.05,14]tetradeca-5(14),6,8-triene is c1cc2c3c(c1)CNCCN3CCC2.
What is the InChIKey of 1,11-diazatricyclo[7.4.1.05,14]tetradeca-5(14),6,8-triene?
The InChIKey is BBFXEOWPELWKIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2/c1-3-10-5-2-7-14-8-6-13-9-11(4-1)12(10)14/h1,3-4,13H,2,5-9H2.
What are the key properties of 1,11-diazatricyclo[7.4.1.05,14]tetradeca-5(14),6,8-triene?
1,11-diazatricyclo[7.4.1.05,14]tetradeca-5(14),6,8-triene has a molecular weight of 188.27 g/mol, XLogP of 1.54, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,11-diazatricyclo[7.4.1.05,14]tetradeca-5(14),6,8-triene is sourced from PubChem (CID 22036724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).