C19H27N3O2 — CID 22036775
ethyl 2,2,4-trimethyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene-12-carboxylate (PubChem CID 22036775) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is ethyl 2,2,4-trimethyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene-12-carboxylate.
| Compound Name | ethyl 2,2,4-trimethyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene-12-carboxylate |
|---|---|
| PubChem CID | 22036775 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | ethyl 2,2,4-trimethyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene-12-carboxylate |
| SMILES | CCOC(=O)N1CCC2C(C1)c1cccc3c1N2C(C)(C)CN3C |
| InChI | InChI=1S/C19H27N3O2/c1-5-24-18(23)21-10-9-15-14(11-21)13-7-6-8-16-17(13)22(15)19(2,3)12-20(16)4/h6-8,14-15H,5,9-12H2,1-4H3 |
| InChIKey | AQOAJSNJMGGYSU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |