C19H22F2N8O2 — CID 22036837
2-(difluoromethyl)-1-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)benzimidazol-4-amine (PubChem CID 22036837) has the molecular formula C19H22F2N8O2 and a molecular weight of 432.44 g/mol. Its IUPAC name is 2-(difluoromethyl)-1-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)benzimidazol-4-amine.
| Compound Name | 2-(difluoromethyl)-1-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)benzimidazol-4-amine |
|---|---|
| PubChem CID | 22036837 |
| Molecular Formula | C19H22F2N8O2 |
| Molecular Weight | 432.44 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 2-(difluoromethyl)-1-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)benzimidazol-4-amine |
| SMILES | Nc1cccc2c1nc(C(F)F)n2-c1nc(N2CCOCC2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C19H22F2N8O2/c20-15(21)16-23-14-12(22)2-1-3-13(14)29(16)19-25-17(27-4-8-30-9-5-27)24-18(26-19)28-6-10-31-11-7-28/h1-3,15H,4-11,22H2 |
| InChIKey | LRYSHDDWCVYSPV-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.44 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|