C19H20ClN5 — CID 22037576
1-[5-(4-chlorophenyl)-4-pyridin-4-yl-1H-pyrazol-3-yl]-3-methylpiperazine (PubChem CID 22037576) has the molecular formula C19H20ClN5 and a molecular weight of 353.86 g/mol. Its IUPAC name is 1-[5-(4-chlorophenyl)-4-pyridin-4-yl-1H-pyrazol-3-yl]-3-methylpiperazine.
| Compound Name | 1-[5-(4-chlorophenyl)-4-pyridin-4-yl-1H-pyrazol-3-yl]-3-methylpiperazine |
|---|---|
| PubChem CID | 22037576 |
| Molecular Formula | C19H20ClN5 |
| Molecular Weight | 353.86 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 1-[5-(4-chlorophenyl)-4-pyridin-4-yl-1H-pyrazol-3-yl]-3-methylpiperazine |
| SMILES | CC1CN(c2n[nH]c(-c3ccc(Cl)cc3)c2-c2ccncc2)CCN1 |
| InChI | InChI=1S/C19H20ClN5/c1-13-12-25(11-10-22-13)19-17(14-6-8-21-9-7-14)18(23-24-19)15-2-4-16(20)5-3-15/h2-9,13,22H,10-12H2,1H3,(H,23,24) |
| InChIKey | ROYXMGVXIACORO-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.86 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |