About 1H-pyrazole;pyrrole-2,5-dione
1H-pyrazole;pyrrole-2,5-dione (PubChem CID 22037740) has the molecular formula C7H7N3O2
and a molecular weight of 165.15 g/mol. Its IUPAC name is 1H-pyrazole;pyrrole-2,5-dione.
Molecular Properties
| Compound Name | 1H-pyrazole;pyrrole-2,5-dione |
| PubChem CID | 22037740 |
| Molecular Formula | C7H7N3O2 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.05 |
| IUPAC Name | 1H-pyrazole;pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1.c1cn[nH]c1 |
| InChI | InChI=1S/C4H3NO2.C3H4N2/c6-3-1-2-4(7)5-3;1-2-4-5-3-1/h1-2H,(H,5,6,7);1-3H,(H,4,5) |
| InChIKey | KWIWLRCKBLSFPI-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1H-pyrazole;pyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrazole;pyrrole-2,5-dione?
The IUPAC name of 1H-pyrazole;pyrrole-2,5-dione (CID 22037740) is 1H-pyrazole;pyrrole-2,5-dione.
What is the SMILES notation for 1H-pyrazole;pyrrole-2,5-dione?
The canonical SMILES for 1H-pyrazole;pyrrole-2,5-dione is O=C1C=CC(=O)N1.c1cn[nH]c1.
What is the InChIKey of 1H-pyrazole;pyrrole-2,5-dione?
The InChIKey is KWIWLRCKBLSFPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3NO2.C3H4N2/c6-3-1-2-4(7)5-3;1-2-4-5-3-1/h1-2H,(H,5,6,7);1-3H,(H,4,5).
What are the key properties of 1H-pyrazole;pyrrole-2,5-dione?
1H-pyrazole;pyrrole-2,5-dione has a molecular weight of 165.15 g/mol, XLogP of -0.39, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrazole;pyrrole-2,5-dione is sourced from PubChem (CID 22037740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).