C26H28N6O3 — CID 22041042
4-[[2-[4-(4-ethylpiperazin-1-yl)anilino]-1,3-benzoxazol-5-yl]oxy]-N-methylpyridine-2-carboxamide (PubChem CID 22041042) has the molecular formula C26H28N6O3 and a molecular weight of 472.55 g/mol. Its IUPAC name is 4-[[2-[4-(4-ethylpiperazin-1-yl)anilino]-1,3-benzoxazol-5-yl]oxy]-N-methylpyridine-2-carboxamide.
| Compound Name | 4-[[2-[4-(4-ethylpiperazin-1-yl)anilino]-1,3-benzoxazol-5-yl]oxy]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 22041042 |
| Molecular Formula | C26H28N6O3 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | 4-[[2-[4-(4-ethylpiperazin-1-yl)anilino]-1,3-benzoxazol-5-yl]oxy]-N-methylpyridine-2-carboxamide |
| SMILES | CCN1CCN(c2ccc(Nc3nc4cc(Oc5ccnc(C(=O)NC)c5)ccc4o3)cc2)CC1 |
| InChI | InChI=1S/C26H28N6O3/c1-3-31-12-14-32(15-13-31)19-6-4-18(5-7-19)29-26-30-22-16-20(8-9-24(22)35-26)34-21-10-11-28-23(17-21)25(33)27-2/h4-11,16-17H,3,12-15H2,1-2H3,(H,27,33)(H,29,30) |
| InChIKey | ZWGXLMYFYRQJBC-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 95.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|