About 1-Bromo-2-(trifluoromethyl)cyclohexa-1,3-diene
1-Bromo-2-(trifluoromethyl)cyclohexa-1,3-diene (PubChem CID 22041247) has the molecular formula C7H6BrF3
and a molecular weight of 227.02 g/mol. Its IUPAC name is 1-bromo-2-(trifluoromethyl)cyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 1-Bromo-2-(trifluoromethyl)cyclohexa-1,3-diene |
| PubChem CID | 22041247 |
| Molecular Formula | C7H6BrF3 |
| Molecular Weight | 227.02 g/mol |
| Exact Mass | 225.96 |
| IUPAC Name | 1-bromo-2-(trifluoromethyl)cyclohexa-1,3-diene |
| SMILES | C1CC(=C(C=C1)C(F)(F)F)Br |
| InChI | InChI=1S/C7H6BrF3/c8-6-4-2-1-3-5(6)7(9,10)11/h1,3H,2,4H2 |
| InChIKey | HBEMUMQWWVLEEM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | 212 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.02 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-Bromo-2-(trifluoromethyl)cyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-Bromo-2-(trifluoromethyl)cyclohexa-1,3-diene?
The IUPAC name of 1-Bromo-2-(trifluoromethyl)cyclohexa-1,3-diene (CID 22041247) is 1-bromo-2-(trifluoromethyl)cyclohexa-1,3-diene.
What is the SMILES notation for 1-Bromo-2-(trifluoromethyl)cyclohexa-1,3-diene?
The canonical SMILES for 1-Bromo-2-(trifluoromethyl)cyclohexa-1,3-diene is C1CC(=C(C=C1)C(F)(F)F)Br.
What is the InChIKey of 1-Bromo-2-(trifluoromethyl)cyclohexa-1,3-diene?
The InChIKey is HBEMUMQWWVLEEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BrF3/c8-6-4-2-1-3-5(6)7(9,10)11/h1,3H,2,4H2.
What are the key properties of 1-Bromo-2-(trifluoromethyl)cyclohexa-1,3-diene?
1-Bromo-2-(trifluoromethyl)cyclohexa-1,3-diene has a molecular weight of 227.02 g/mol, XLogP of 3.00, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-Bromo-2-(trifluoromethyl)cyclohexa-1,3-diene is sourced from PubChem (CID 22041247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).