About 6-methyl-1,4-di(propan-2-yl)-2,3-dihydroquinoxaline
6-methyl-1,4-di(propan-2-yl)-2,3-dihydroquinoxaline (PubChem CID 22041393) has the molecular formula C15H24N2
and a molecular weight of 232.37 g/mol. Its IUPAC name is 6-methyl-1,4-di(propan-2-yl)-2,3-dihydroquinoxaline.
Molecular Properties
| Compound Name | 6-methyl-1,4-di(propan-2-yl)-2,3-dihydroquinoxaline |
| PubChem CID | 22041393 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | 6-methyl-1,4-di(propan-2-yl)-2,3-dihydroquinoxaline |
| SMILES | Cc1ccc2c(c1)N(C(C)C)CCN2C(C)C |
| InChI | InChI=1S/C15H24N2/c1-11(2)16-8-9-17(12(3)4)15-10-13(5)6-7-14(15)16/h6-7,10-12H,8-9H2,1-5H3 |
| InChIKey | AYYUMOFZWGBHKI-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methyl-1,4-di(propan-2-yl)-2,3-dihydroquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-1,4-di(propan-2-yl)-2,3-dihydroquinoxaline?
The IUPAC name of 6-methyl-1,4-di(propan-2-yl)-2,3-dihydroquinoxaline (CID 22041393) is 6-methyl-1,4-di(propan-2-yl)-2,3-dihydroquinoxaline.
What is the SMILES notation for 6-methyl-1,4-di(propan-2-yl)-2,3-dihydroquinoxaline?
The canonical SMILES for 6-methyl-1,4-di(propan-2-yl)-2,3-dihydroquinoxaline is Cc1ccc2c(c1)N(C(C)C)CCN2C(C)C.
What is the InChIKey of 6-methyl-1,4-di(propan-2-yl)-2,3-dihydroquinoxaline?
The InChIKey is AYYUMOFZWGBHKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2/c1-11(2)16-8-9-17(12(3)4)15-10-13(5)6-7-14(15)16/h6-7,10-12H,8-9H2,1-5H3.
What are the key properties of 6-methyl-1,4-di(propan-2-yl)-2,3-dihydroquinoxaline?
6-methyl-1,4-di(propan-2-yl)-2,3-dihydroquinoxaline has a molecular weight of 232.37 g/mol, XLogP of 3.44, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-1,4-di(propan-2-yl)-2,3-dihydroquinoxaline is sourced from PubChem (CID 22041393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).