C19H22ClN5O3 — CID 22041704
2-chloro-5-[4-(cyanomethyl)-5-oxo-1,2,4-triazol-1-yl]-N-[cycloheptyl(hydroxy)methyl]benzamide (PubChem CID 22041704) has the molecular formula C19H22ClN5O3 and a molecular weight of 403.87 g/mol. Its IUPAC name is 2-chloro-5-[4-(cyanomethyl)-5-oxo-1,2,4-triazol-1-yl]-N-[cycloheptyl(hydroxy)methyl]benzamide.
| Compound Name | 2-chloro-5-[4-(cyanomethyl)-5-oxo-1,2,4-triazol-1-yl]-N-[cycloheptyl(hydroxy)methyl]benzamide |
|---|---|
| PubChem CID | 22041704 |
| Molecular Formula | C19H22ClN5O3 |
| Molecular Weight | 403.87 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 2-chloro-5-[4-(cyanomethyl)-5-oxo-1,2,4-triazol-1-yl]-N-[cycloheptyl(hydroxy)methyl]benzamide |
| SMILES | N#CCn1cnn(-c2ccc(Cl)c(C(=O)NC(O)C3CCCCCC3)c2)c1=O |
| InChI | InChI=1S/C19H22ClN5O3/c20-16-8-7-14(25-19(28)24(10-9-21)12-22-25)11-15(16)18(27)23-17(26)13-5-3-1-2-4-6-13/h7-8,11-13,17,26H,1-6,10H2,(H,23,27) |
| InChIKey | VHLWRNUVRHVBFM-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 112.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.87 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|