About 2-[4-chloro-5-(2,3-dihydroindol-1-ylsulfonyl)-2-methylphenoxy]-N-cyclohexylacetamide
2-[4-chloro-5-(2,3-dihydroindol-1-ylsulfonyl)-2-methylphenoxy]-N-cyclohexylacetamide (PubChem CID 2204207) has the molecular formula C23H27ClN2O4S
and a molecular weight of 463.00 g/mol. Its IUPAC name is 2-[4-chloro-5-(2,3-dihydroindol-1-ylsulfonyl)-2-methylphenoxy]-N-cyclohexylacetamide.
Molecular Properties
| Compound Name | 2-[4-chloro-5-(2,3-dihydroindol-1-ylsulfonyl)-2-methylphenoxy]-N-cyclohexylacetamide |
| PubChem CID | 2204207 |
| Molecular Formula | C23H27ClN2O4S |
| Molecular Weight | 463.00 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | 2-[4-chloro-5-(2,3-dihydroindol-1-ylsulfonyl)-2-methylphenoxy]-N-cyclohexylacetamide |
| SMILES | Cc1cc(Cl)c(S(=O)(=O)N2CCc3ccccc32)cc1OCC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C23H27ClN2O4S/c1-16-13-19(24)22(31(28,29)26-12-11-17-7-5-6-10-20(17)26)14-21(16)30-15-23(27)25-18-8-3-2-4-9-18/h5-7,10,13-14,18H,2-4,8-9,11-12,15H2,1H3,(H,25,27) |
| InChIKey | VQHIKBWSDVFZOY-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 463.00 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-chloro-5-(2,3-dihydroindol-1-ylsulfonyl)-2-methylphenoxy]-N-cyclohexylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-chloro-5-(2,3-dihydroindol-1-ylsulfonyl)-2-methylphenoxy]-N-cyclohexylacetamide?
The IUPAC name of 2-[4-chloro-5-(2,3-dihydroindol-1-ylsulfonyl)-2-methylphenoxy]-N-cyclohexylacetamide (CID 2204207) is 2-[4-chloro-5-(2,3-dihydroindol-1-ylsulfonyl)-2-methylphenoxy]-N-cyclohexylacetamide.
What is the SMILES notation for 2-[4-chloro-5-(2,3-dihydroindol-1-ylsulfonyl)-2-methylphenoxy]-N-cyclohexylacetamide?
The canonical SMILES for 2-[4-chloro-5-(2,3-dihydroindol-1-ylsulfonyl)-2-methylphenoxy]-N-cyclohexylacetamide is Cc1cc(Cl)c(S(=O)(=O)N2CCc3ccccc32)cc1OCC(=O)NC1CCCCC1.
What is the InChIKey of 2-[4-chloro-5-(2,3-dihydroindol-1-ylsulfonyl)-2-methylphenoxy]-N-cyclohexylacetamide?
The InChIKey is VQHIKBWSDVFZOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27ClN2O4S/c1-16-13-19(24)22(31(28,29)26-12-11-17-7-5-6-10-20(17)26)14-21(16)30-15-23(27)25-18-8-3-2-4-9-18/h5-7,10,13-14,18H,2-4,8-9,11-12,15H2,1H3,(H,25,27).
What are the key properties of 2-[4-chloro-5-(2,3-dihydroindol-1-ylsulfonyl)-2-methylphenoxy]-N-cyclohexylacetamide?
2-[4-chloro-5-(2,3-dihydroindol-1-ylsulfonyl)-2-methylphenoxy]-N-cyclohexylacetamide has a molecular weight of 463.00 g/mol, XLogP of 4.23, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-chloro-5-(2,3-dihydroindol-1-ylsulfonyl)-2-methylphenoxy]-N-cyclohexylacetamide is sourced from PubChem (CID 2204207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).