About 2-[1-(2-propyl-1,3-dioxolan-2-yl)cyclopropyl]ethanol
2-[1-(2-propyl-1,3-dioxolan-2-yl)cyclopropyl]ethanol (PubChem CID 22042453) has the molecular formula C11H20O3
and a molecular weight of 200.28 g/mol. Its IUPAC name is 2-[1-(2-propyl-1,3-dioxolan-2-yl)cyclopropyl]ethanol.
Molecular Properties
| Compound Name | 2-[1-(2-propyl-1,3-dioxolan-2-yl)cyclopropyl]ethanol |
| PubChem CID | 22042453 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | 2-[1-(2-propyl-1,3-dioxolan-2-yl)cyclopropyl]ethanol |
| SMILES | CCCC1(C2(CCO)CC2)OCCO1 |
| InChI | InChI=1S/C11H20O3/c1-2-3-11(13-8-9-14-11)10(4-5-10)6-7-12/h12H,2-9H2,1H3 |
| InChIKey | FJAFIOVTUJZNRL-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[1-(2-propyl-1,3-dioxolan-2-yl)cyclopropyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(2-propyl-1,3-dioxolan-2-yl)cyclopropyl]ethanol?
The IUPAC name of 2-[1-(2-propyl-1,3-dioxolan-2-yl)cyclopropyl]ethanol (CID 22042453) is 2-[1-(2-propyl-1,3-dioxolan-2-yl)cyclopropyl]ethanol.
What is the SMILES notation for 2-[1-(2-propyl-1,3-dioxolan-2-yl)cyclopropyl]ethanol?
The canonical SMILES for 2-[1-(2-propyl-1,3-dioxolan-2-yl)cyclopropyl]ethanol is CCCC1(C2(CCO)CC2)OCCO1.
What is the InChIKey of 2-[1-(2-propyl-1,3-dioxolan-2-yl)cyclopropyl]ethanol?
The InChIKey is FJAFIOVTUJZNRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O3/c1-2-3-11(13-8-9-14-11)10(4-5-10)6-7-12/h12H,2-9H2,1H3.
What are the key properties of 2-[1-(2-propyl-1,3-dioxolan-2-yl)cyclopropyl]ethanol?
2-[1-(2-propyl-1,3-dioxolan-2-yl)cyclopropyl]ethanol has a molecular weight of 200.28 g/mol, XLogP of 1.69, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(2-propyl-1,3-dioxolan-2-yl)cyclopropyl]ethanol is sourced from PubChem (CID 22042453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).