About 4-bromo-N,2-dimethylaniline
4-bromo-N,2-dimethylaniline (PubChem CID 22042599) has the molecular formula C8H10BrN
and a molecular weight of 200.08 g/mol. Its IUPAC name is 4-bromo-N,2-dimethylaniline.
Molecular Properties
| Compound Name | 4-bromo-N,2-dimethylaniline |
| PubChem CID | 22042599 |
| Molecular Formula | C8H10BrN |
| Molecular Weight | 200.08 g/mol |
| Exact Mass | 199.00 |
| IUPAC Name | 4-bromo-N,2-dimethylaniline |
| SMILES | CNc1ccc(Br)cc1C |
| InChI | InChI=1S/C8H10BrN/c1-6-5-7(9)3-4-8(6)10-2/h3-5,10H,1-2H3 |
| InChIKey | VCZTYYHYOULJLT-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.08 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-bromo-N,2-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N,2-dimethylaniline?
The IUPAC name of 4-bromo-N,2-dimethylaniline (CID 22042599) is 4-bromo-N,2-dimethylaniline.
What is the SMILES notation for 4-bromo-N,2-dimethylaniline?
The canonical SMILES for 4-bromo-N,2-dimethylaniline is CNc1ccc(Br)cc1C.
What is the InChIKey of 4-bromo-N,2-dimethylaniline?
The InChIKey is VCZTYYHYOULJLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10BrN/c1-6-5-7(9)3-4-8(6)10-2/h3-5,10H,1-2H3.
What are the key properties of 4-bromo-N,2-dimethylaniline?
4-bromo-N,2-dimethylaniline has a molecular weight of 200.08 g/mol, XLogP of 2.80, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N,2-dimethylaniline is sourced from PubChem (CID 22042599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).