C25H23F3N2O3S — CID 22042611
N-(2-methylpropyl)-N-[4-(1,1,1-trifluoro-2-hydroxy-4-pyridin-3-ylbut-3-yn-2-yl)phenyl]benzenesulfonamide (PubChem CID 22042611) has the molecular formula C25H23F3N2O3S and a molecular weight of 488.53 g/mol. Its IUPAC name is N-(2-methylpropyl)-N-[4-(1,1,1-trifluoro-2-hydroxy-4-pyridin-3-ylbut-3-yn-2-yl)phenyl]benzenesulfonamide.
| Compound Name | N-(2-methylpropyl)-N-[4-(1,1,1-trifluoro-2-hydroxy-4-pyridin-3-ylbut-3-yn-2-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 22042611 |
| Molecular Formula | C25H23F3N2O3S |
| Molecular Weight | 488.53 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | N-(2-methylpropyl)-N-[4-(1,1,1-trifluoro-2-hydroxy-4-pyridin-3-ylbut-3-yn-2-yl)phenyl]benzenesulfonamide |
| SMILES | CC(C)CN(c1ccc(C(O)(C#Cc2cccnc2)C(F)(F)F)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H23F3N2O3S/c1-19(2)18-30(34(32,33)23-8-4-3-5-9-23)22-12-10-21(11-13-22)24(31,25(26,27)28)15-14-20-7-6-16-29-17-20/h3-13,16-17,19,31H,18H2,1-2H3 |
| InChIKey | YMCZPIAWBPMWLT-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.53 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|