C25H20N2O5 — CID 2204372
3-[5-[(2,2-diphenylacetyl)amino]-1,3-dioxoisoindol-2-yl]propanoic acid (PubChem CID 2204372) has the molecular formula C25H20N2O5 and a molecular weight of 428.44 g/mol. Its IUPAC name is 3-[5-[(2,2-diphenylacetyl)amino]-1,3-dioxoisoindol-2-yl]propanoic acid.
| Compound Name | 3-[5-[(2,2-diphenylacetyl)amino]-1,3-dioxoisoindol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 2204372 |
| Molecular Formula | C25H20N2O5 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 3-[5-[(2,2-diphenylacetyl)amino]-1,3-dioxoisoindol-2-yl]propanoic acid |
| SMILES | O=C(O)CCN1C(=O)c2ccc(NC(=O)C(c3ccccc3)c3ccccc3)cc2C1=O |
| InChI | InChI=1S/C25H20N2O5/c28-21(29)13-14-27-24(31)19-12-11-18(15-20(19)25(27)32)26-23(30)22(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-12,15,22H,13-14H2,(H,26,30)(H,28,29) |
| InChIKey | SLDQPXNWACFAGQ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|