C6H11NO6 — CID 22044432
2-[carboxymethyl(1,1-dihydroxyethyl)amino]acetic acid (PubChem CID 22044432) has the molecular formula C6H11NO6 and a molecular weight of 193.15 g/mol. Its IUPAC name is 2-[carboxymethyl(1,1-dihydroxyethyl)amino]acetic acid.
| Compound Name | 2-[carboxymethyl(1,1-dihydroxyethyl)amino]acetic acid |
|---|---|
| PubChem CID | 22044432 |
| Molecular Formula | C6H11NO6 |
| Molecular Weight | 193.15 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | 2-[carboxymethyl(1,1-dihydroxyethyl)amino]acetic acid |
| SMILES | CC(O)(O)N(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C6H11NO6/c1-6(12,13)7(2-4(8)9)3-5(10)11/h12-13H,2-3H2,1H3,(H,8,9)(H,10,11) |
| InChIKey | SJQRPXNDEPVOQQ-UHFFFAOYSA-N |
| XLogP | -1.88 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.15 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|