C10H12O11 — CID 22044544
2-(3-carboxy-2-hydroxypropanoyl)oxypropane-1,2,3-tricarboxylic acid (PubChem CID 22044544) has the molecular formula C10H12O11 and a molecular weight of 308.20 g/mol. Its IUPAC name is 2-(3-carboxy-2-hydroxypropanoyl)oxypropane-1,2,3-tricarboxylic acid.
| Compound Name | 2-(3-carboxy-2-hydroxypropanoyl)oxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 22044544 |
| Molecular Formula | C10H12O11 |
| Molecular Weight | 308.20 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 2-(3-carboxy-2-hydroxypropanoyl)oxypropane-1,2,3-tricarboxylic acid |
| SMILES | O=C(O)CC(O)C(=O)OC(CC(=O)O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H12O11/c11-4(1-5(12)13)8(18)21-10(9(19)20,2-6(14)15)3-7(16)17/h4,11H,1-3H2,(H,12,13)(H,14,15)(H,16,17)(H,19,20) |
| InChIKey | WZRARBVJAZLGTG-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 195.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.20 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |