About (4-fluorophenyl)methyl 2-[[2-[(4-methylbenzoyl)amino]acetyl]amino]acetate
(4-fluorophenyl)methyl 2-[[2-[(4-methylbenzoyl)amino]acetyl]amino]acetate (PubChem CID 2204513) has the molecular formula C19H19FN2O4
and a molecular weight of 358.37 g/mol. Its IUPAC name is (4-fluorophenyl)methyl 2-[[2-[(4-methylbenzoyl)amino]acetyl]amino]acetate.
Molecular Properties
| Compound Name | (4-fluorophenyl)methyl 2-[[2-[(4-methylbenzoyl)amino]acetyl]amino]acetate |
| PubChem CID | 2204513 |
| Molecular Formula | C19H19FN2O4 |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | (4-fluorophenyl)methyl 2-[[2-[(4-methylbenzoyl)amino]acetyl]amino]acetate |
| SMILES | Cc1ccc(C(=O)NCC(=O)NCC(=O)OCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C19H19FN2O4/c1-13-2-6-15(7-3-13)19(25)22-10-17(23)21-11-18(24)26-12-14-4-8-16(20)9-5-14/h2-9H,10-12H2,1H3,(H,21,23)(H,22,25) |
| InChIKey | OWUAJRWIZXBRGM-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-fluorophenyl)methyl 2-[[2-[(4-methylbenzoyl)amino]acetyl]amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-fluorophenyl)methyl 2-[[2-[(4-methylbenzoyl)amino]acetyl]amino]acetate?
The IUPAC name of (4-fluorophenyl)methyl 2-[[2-[(4-methylbenzoyl)amino]acetyl]amino]acetate (CID 2204513) is (4-fluorophenyl)methyl 2-[[2-[(4-methylbenzoyl)amino]acetyl]amino]acetate.
What is the SMILES notation for (4-fluorophenyl)methyl 2-[[2-[(4-methylbenzoyl)amino]acetyl]amino]acetate?
The canonical SMILES for (4-fluorophenyl)methyl 2-[[2-[(4-methylbenzoyl)amino]acetyl]amino]acetate is Cc1ccc(C(=O)NCC(=O)NCC(=O)OCc2ccc(F)cc2)cc1.
What is the InChIKey of (4-fluorophenyl)methyl 2-[[2-[(4-methylbenzoyl)amino]acetyl]amino]acetate?
The InChIKey is OWUAJRWIZXBRGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19FN2O4/c1-13-2-6-15(7-3-13)19(25)22-10-17(23)21-11-18(24)26-12-14-4-8-16(20)9-5-14/h2-9H,10-12H2,1H3,(H,21,23)(H,22,25).
What are the key properties of (4-fluorophenyl)methyl 2-[[2-[(4-methylbenzoyl)amino]acetyl]amino]acetate?
(4-fluorophenyl)methyl 2-[[2-[(4-methylbenzoyl)amino]acetyl]amino]acetate has a molecular weight of 358.37 g/mol, XLogP of 1.72, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-fluorophenyl)methyl 2-[[2-[(4-methylbenzoyl)amino]acetyl]amino]acetate is sourced from PubChem (CID 2204513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).