C26H30F2O — CID 22045243
2-[4-(difluoromethoxy)phenyl]-7-[(E)-pent-1-enyl]-1,2,3,4,5,6,7,8-octahydrophenanthrene (PubChem CID 22045243) has the molecular formula C26H30F2O and a molecular weight of 396.52 g/mol. Its IUPAC name is 2-[4-(difluoromethoxy)phenyl]-7-[(E)-pent-1-enyl]-1,2,3,4,5,6,7,8-octahydrophenanthrene.
| Compound Name | 2-[4-(difluoromethoxy)phenyl]-7-[(E)-pent-1-enyl]-1,2,3,4,5,6,7,8-octahydrophenanthrene |
|---|---|
| PubChem CID | 22045243 |
| Molecular Formula | C26H30F2O |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 2-[4-(difluoromethoxy)phenyl]-7-[(E)-pent-1-enyl]-1,2,3,4,5,6,7,8-octahydrophenanthrene |
| SMILES | CCC/C=C/C1CCc2c(ccc3c2CCC(c2ccc(OC(F)F)cc2)C3)C1 |
| InChI | InChI=1S/C26H30F2O/c1-2-3-4-5-18-6-14-24-21(16-18)7-8-22-17-20(11-15-25(22)24)19-9-12-23(13-10-19)29-26(27)28/h4-5,7-10,12-13,18,20,26H,2-3,6,11,14-17H2,1H3/b5-4+ |
| InChIKey | FTCGCZXUSMVHQM-SNAWJCMRSA-N |
| XLogP | 7.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|