C24H25F3 — CID 22045249
2-[(E)-but-1-enyl]-7-(3,4,5-trifluorophenyl)-1,2,3,4,5,6,7,8-octahydrophenanthrene (PubChem CID 22045249) has the molecular formula C24H25F3 and a molecular weight of 370.46 g/mol. Its IUPAC name is 2-[(E)-but-1-enyl]-7-(3,4,5-trifluorophenyl)-1,2,3,4,5,6,7,8-octahydrophenanthrene.
| Compound Name | 2-[(E)-but-1-enyl]-7-(3,4,5-trifluorophenyl)-1,2,3,4,5,6,7,8-octahydrophenanthrene |
|---|---|
| PubChem CID | 22045249 |
| Molecular Formula | C24H25F3 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 2-[(E)-but-1-enyl]-7-(3,4,5-trifluorophenyl)-1,2,3,4,5,6,7,8-octahydrophenanthrene |
| SMILES | CC/C=C/C1CCc2c(ccc3c2CCC(c2cc(F)c(F)c(F)c2)C3)C1 |
| InChI | InChI=1S/C24H25F3/c1-2-3-4-15-5-9-20-17(11-15)6-7-18-12-16(8-10-21(18)20)19-13-22(25)24(27)23(26)14-19/h3-4,6-7,13-16H,2,5,8-12H2,1H3/b4-3+ |
| InChIKey | NWVMIVHTYQMREO-ONEGZZNKSA-N |
| XLogP | 6.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|