C24H26ClF — CID 22045299
2-[(E)-but-1-enyl]-7-(4-chloro-3-fluorophenyl)-1,2,3,4,5,6,7,8-octahydrophenanthrene (PubChem CID 22045299) has the molecular formula C24H26ClF and a molecular weight of 368.92 g/mol. Its IUPAC name is 2-[(E)-but-1-enyl]-7-(4-chloro-3-fluorophenyl)-1,2,3,4,5,6,7,8-octahydrophenanthrene.
| Compound Name | 2-[(E)-but-1-enyl]-7-(4-chloro-3-fluorophenyl)-1,2,3,4,5,6,7,8-octahydrophenanthrene |
|---|---|
| PubChem CID | 22045299 |
| Molecular Formula | C24H26ClF |
| Molecular Weight | 368.92 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 2-[(E)-but-1-enyl]-7-(4-chloro-3-fluorophenyl)-1,2,3,4,5,6,7,8-octahydrophenanthrene |
| SMILES | CC/C=C/C1CCc2c(ccc3c2CCC(c2ccc(Cl)c(F)c2)C3)C1 |
| InChI | InChI=1S/C24H26ClF/c1-2-3-4-16-5-10-21-19(13-16)6-7-20-14-17(8-11-22(20)21)18-9-12-23(25)24(26)15-18/h3-4,6-7,9,12,15-17H,2,5,8,10-11,13-14H2,1H3/b4-3+ |
| InChIKey | XISQTDZZBIJIRW-ONEGZZNKSA-N |
| XLogP | 6.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.92 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|