About 2-[2-(4-chloro-3-fluorophenyl)ethynyl]-7-propyl-9,10-dihydrophenanthrene
2-[2-(4-chloro-3-fluorophenyl)ethynyl]-7-propyl-9,10-dihydrophenanthrene (PubChem CID 22045378) has the molecular formula C25H20ClF
and a molecular weight of 374.89 g/mol. Its IUPAC name is 2-[2-(4-chloro-3-fluorophenyl)ethynyl]-7-propyl-9,10-dihydrophenanthrene.
Molecular Properties
| Compound Name | 2-[2-(4-chloro-3-fluorophenyl)ethynyl]-7-propyl-9,10-dihydrophenanthrene |
| PubChem CID | 22045378 |
| Molecular Formula | C25H20ClF |
| Molecular Weight | 374.89 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 2-[2-(4-chloro-3-fluorophenyl)ethynyl]-7-propyl-9,10-dihydrophenanthrene |
| SMILES | CCCc1ccc2c(c1)CCc1cc(C#Cc3ccc(Cl)c(F)c3)ccc1-2 |
| InChI | InChI=1S/C25H20ClF/c1-2-3-17-6-11-22-20(14-17)9-10-21-15-18(7-12-23(21)22)4-5-19-8-13-24(26)25(27)16-19/h6-8,11-16H,2-3,9-10H2,1H3 |
| InChIKey | HBWKLPYEIXWAFS-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.89 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(4-chloro-3-fluorophenyl)ethynyl]-7-propyl-9,10-dihydrophenanthrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(4-chloro-3-fluorophenyl)ethynyl]-7-propyl-9,10-dihydrophenanthrene?
The IUPAC name of 2-[2-(4-chloro-3-fluorophenyl)ethynyl]-7-propyl-9,10-dihydrophenanthrene (CID 22045378) is 2-[2-(4-chloro-3-fluorophenyl)ethynyl]-7-propyl-9,10-dihydrophenanthrene.
What is the SMILES notation for 2-[2-(4-chloro-3-fluorophenyl)ethynyl]-7-propyl-9,10-dihydrophenanthrene?
The canonical SMILES for 2-[2-(4-chloro-3-fluorophenyl)ethynyl]-7-propyl-9,10-dihydrophenanthrene is CCCc1ccc2c(c1)CCc1cc(C#Cc3ccc(Cl)c(F)c3)ccc1-2.
What is the InChIKey of 2-[2-(4-chloro-3-fluorophenyl)ethynyl]-7-propyl-9,10-dihydrophenanthrene?
The InChIKey is HBWKLPYEIXWAFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H20ClF/c1-2-3-17-6-11-22-20(14-17)9-10-21-15-18(7-12-23(21)22)4-5-19-8-13-24(26)25(27)16-19/h6-8,11-16H,2-3,9-10H2,1H3.
What are the key properties of 2-[2-(4-chloro-3-fluorophenyl)ethynyl]-7-propyl-9,10-dihydrophenanthrene?
2-[2-(4-chloro-3-fluorophenyl)ethynyl]-7-propyl-9,10-dihydrophenanthrene has a molecular weight of 374.89 g/mol, XLogP of 6.60, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(4-chloro-3-fluorophenyl)ethynyl]-7-propyl-9,10-dihydrophenanthrene is sourced from PubChem (CID 22045378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).