About 2-aminopentanenitrile;methanesulfonic acid
2-aminopentanenitrile;methanesulfonic acid (PubChem CID 22045930) has the molecular formula C6H14N2O3S
and a molecular weight of 194.26 g/mol. Its IUPAC name is 2-aminopentanenitrile;methanesulfonic acid.
Molecular Properties
| Compound Name | 2-aminopentanenitrile;methanesulfonic acid |
| PubChem CID | 22045930 |
| Molecular Formula | C6H14N2O3S |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | 2-aminopentanenitrile;methanesulfonic acid |
| SMILES | CCCC(N)C#N.CS(=O)(=O)O |
| InChI | InChI=1S/C5H10N2.CH4O3S/c1-2-3-5(7)4-6;1-5(2,3)4/h5H,2-3,7H2,1H3;1H3,(H,2,3,4) |
| InChIKey | NWDUUMKBQJCPDE-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 104.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-aminopentanenitrile;methanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminopentanenitrile;methanesulfonic acid?
The IUPAC name of 2-aminopentanenitrile;methanesulfonic acid (CID 22045930) is 2-aminopentanenitrile;methanesulfonic acid.
What is the SMILES notation for 2-aminopentanenitrile;methanesulfonic acid?
The canonical SMILES for 2-aminopentanenitrile;methanesulfonic acid is CCCC(N)C#N.CS(=O)(=O)O.
What is the InChIKey of 2-aminopentanenitrile;methanesulfonic acid?
The InChIKey is NWDUUMKBQJCPDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2.CH4O3S/c1-2-3-5(7)4-6;1-5(2,3)4/h5H,2-3,7H2,1H3;1H3,(H,2,3,4).
What are the key properties of 2-aminopentanenitrile;methanesulfonic acid?
2-aminopentanenitrile;methanesulfonic acid has a molecular weight of 194.26 g/mol, XLogP of 0.14, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminopentanenitrile;methanesulfonic acid is sourced from PubChem (CID 22045930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).