C14H30OSi — CID 22046083
2,2,3,3,4,4,5,5,6,6-decamethyloxasilinane (PubChem CID 22046083) has the molecular formula C14H30OSi and a molecular weight of 242.48 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6-decamethyloxasilinane.
| Compound Name | 2,2,3,3,4,4,5,5,6,6-decamethyloxasilinane |
|---|---|
| PubChem CID | 22046083 |
| Molecular Formula | C14H30OSi |
| Molecular Weight | 242.48 g/mol |
| Exact Mass | 242.21 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6-decamethyloxasilinane |
| SMILES | CC1(C)O[Si](C)(C)C(C)(C)C(C)(C)C1(C)C |
| InChI | InChI=1S/C14H30OSi/c1-11(2)12(3,4)14(7,8)16(9,10)15-13(11,5)6/h1-10H3 |
| InChIKey | PLWQFMDGVVSNAI-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.48 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|