C19H16F3N5O2 — CID 22046483
1-(5-methylpyrazin-2-yl)-3-[2-(pyridin-3-ylmethoxy)-5-(trifluoromethyl)phenyl]urea (PubChem CID 22046483) has the molecular formula C19H16F3N5O2 and a molecular weight of 403.36 g/mol. Its IUPAC name is 1-(5-methylpyrazin-2-yl)-3-[2-(pyridin-3-ylmethoxy)-5-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(5-methylpyrazin-2-yl)-3-[2-(pyridin-3-ylmethoxy)-5-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 22046483 |
| Molecular Formula | C19H16F3N5O2 |
| Molecular Weight | 403.36 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | 1-(5-methylpyrazin-2-yl)-3-[2-(pyridin-3-ylmethoxy)-5-(trifluoromethyl)phenyl]urea |
| SMILES | Cc1cnc(NC(=O)Nc2cc(C(F)(F)F)ccc2OCc2cccnc2)cn1 |
| InChI | InChI=1S/C19H16F3N5O2/c1-12-8-25-17(10-24-12)27-18(28)26-15-7-14(19(20,21)22)4-5-16(15)29-11-13-3-2-6-23-9-13/h2-10H,11H2,1H3,(H2,25,26,27,28) |
| InChIKey | MNLPQUXLIQBKQO-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.36 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |