C18H19F2N3OS — CID 2204665
N-(2,4-difluorophenyl)-4-(2-methoxyphenyl)piperazine-1-carbothioamide (PubChem CID 2204665) has the molecular formula C18H19F2N3OS and a molecular weight of 363.43 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-4-(2-methoxyphenyl)piperazine-1-carbothioamide.
| Compound Name | N-(2,4-difluorophenyl)-4-(2-methoxyphenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 2204665 |
| Molecular Formula | C18H19F2N3OS |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | N-(2,4-difluorophenyl)-4-(2-methoxyphenyl)piperazine-1-carbothioamide |
| SMILES | COc1ccccc1N1CCN(C(=S)Nc2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C18H19F2N3OS/c1-24-17-5-3-2-4-16(17)22-8-10-23(11-9-22)18(25)21-15-7-6-13(19)12-14(15)20/h2-7,12H,8-11H2,1H3,(H,21,25) |
| InChIKey | IYLBBLFVHDDRJY-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|