C24H16F3IN2O4 — CID 22046822
2-[7-iodo-2,5-dioxo-3-[3-(trifluoromethyl)phenyl]-1,3-dihydro-1,4-benzodiazepin-4-yl]-2-phenylacetic acid (PubChem CID 22046822) has the molecular formula C24H16F3IN2O4 and a molecular weight of 580.30 g/mol. Its IUPAC name is 2-[7-iodo-2,5-dioxo-3-[3-(trifluoromethyl)phenyl]-1,3-dihydro-1,4-benzodiazepin-4-yl]-2-phenylacetic acid.
| Compound Name | 2-[7-iodo-2,5-dioxo-3-[3-(trifluoromethyl)phenyl]-1,3-dihydro-1,4-benzodiazepin-4-yl]-2-phenylacetic acid |
|---|---|
| PubChem CID | 22046822 |
| Molecular Formula | C24H16F3IN2O4 |
| Molecular Weight | 580.30 g/mol |
| Exact Mass | 580.01 |
| IUPAC Name | 2-[7-iodo-2,5-dioxo-3-[3-(trifluoromethyl)phenyl]-1,3-dihydro-1,4-benzodiazepin-4-yl]-2-phenylacetic acid |
| SMILES | O=C(O)C(c1ccccc1)N1C(=O)c2cc(I)ccc2NC(=O)C1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H16F3IN2O4/c25-24(26,27)15-8-4-7-14(11-15)19-21(31)29-18-10-9-16(28)12-17(18)22(32)30(19)20(23(33)34)13-5-2-1-3-6-13/h1-12,19-20H,(H,29,31)(H,33,34) |
| InChIKey | XPJQCKZMLAPANY-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.30 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|