C21H15IN2O4S — CID 22046863
2-(7-iodo-2,5-dioxo-3-thiophen-3-yl-1,3-dihydro-1,4-benzodiazepin-4-yl)-2-phenylacetic acid (PubChem CID 22046863) has the molecular formula C21H15IN2O4S and a molecular weight of 518.33 g/mol. Its IUPAC name is 2-(7-iodo-2,5-dioxo-3-thiophen-3-yl-1,3-dihydro-1,4-benzodiazepin-4-yl)-2-phenylacetic acid.
| Compound Name | 2-(7-iodo-2,5-dioxo-3-thiophen-3-yl-1,3-dihydro-1,4-benzodiazepin-4-yl)-2-phenylacetic acid |
|---|---|
| PubChem CID | 22046863 |
| Molecular Formula | C21H15IN2O4S |
| Molecular Weight | 518.33 g/mol |
| Exact Mass | 517.98 |
| IUPAC Name | 2-(7-iodo-2,5-dioxo-3-thiophen-3-yl-1,3-dihydro-1,4-benzodiazepin-4-yl)-2-phenylacetic acid |
| SMILES | O=C(O)C(c1ccccc1)N1C(=O)c2cc(I)ccc2NC(=O)C1c1ccsc1 |
| InChI | InChI=1S/C21H15IN2O4S/c22-14-6-7-16-15(10-14)20(26)24(17(19(25)23-16)13-8-9-29-11-13)18(21(27)28)12-4-2-1-3-5-12/h1-11,17-18H,(H,23,25)(H,27,28) |
| InChIKey | QHKYYVQIJQYTGQ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.33 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|