About 8-methyl-6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzothiazepine
8-methyl-6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzothiazepine (PubChem CID 22047) has the molecular formula C19H21N3S
and a molecular weight of 323.47 g/mol. Its IUPAC name is 8-methyl-6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzothiazepine.
Molecular Properties
| Compound Name | 8-methyl-6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzothiazepine |
| PubChem CID | 22047 |
| Molecular Formula | C19H21N3S |
| Molecular Weight | 323.47 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 8-methyl-6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzothiazepine |
| SMILES | Cc1ccc2c(c1)C(N1CCN(C)CC1)=Nc1ccccc1S2 |
| InChI | InChI=1S/C19H21N3S/c1-14-7-8-17-15(13-14)19(22-11-9-21(2)10-12-22)20-16-5-3-4-6-18(16)23-17/h3-8,13H,9-12H2,1-2H3 |
| InChIKey | IOEPXYJOHIZYGQ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.47 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-methyl-6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzothiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzothiazepine?
The IUPAC name of 8-methyl-6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzothiazepine (CID 22047) is 8-methyl-6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzothiazepine.
What is the SMILES notation for 8-methyl-6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzothiazepine?
The canonical SMILES for 8-methyl-6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzothiazepine is Cc1ccc2c(c1)C(N1CCN(C)CC1)=Nc1ccccc1S2.
What is the InChIKey of 8-methyl-6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzothiazepine?
The InChIKey is IOEPXYJOHIZYGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N3S/c1-14-7-8-17-15(13-14)19(22-11-9-21(2)10-12-22)20-16-5-3-4-6-18(16)23-17/h3-8,13H,9-12H2,1-2H3.
What are the key properties of 8-methyl-6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzothiazepine?
8-methyl-6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzothiazepine has a molecular weight of 323.47 g/mol, XLogP of 3.79, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-6-(4-methylpiperazin-1-yl)benzo[b][1,4]benzothiazepine is sourced from PubChem (CID 22047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).