About (3-chlorofuro[2,3-c]pyridin-5-yl)methanol
(3-chlorofuro[2,3-c]pyridin-5-yl)methanol (PubChem CID 22047165) has the molecular formula C8H6ClNO2
and a molecular weight of 183.59 g/mol. Its IUPAC name is (3-chlorofuro[2,3-c]pyridin-5-yl)methanol.
Molecular Properties
| Compound Name | (3-chlorofuro[2,3-c]pyridin-5-yl)methanol |
| PubChem CID | 22047165 |
| Molecular Formula | C8H6ClNO2 |
| Molecular Weight | 183.59 g/mol |
| Exact Mass | 183.01 |
| IUPAC Name | (3-chlorofuro[2,3-c]pyridin-5-yl)methanol |
| SMILES | OCc1cc2c(Cl)coc2cn1 |
| InChI | InChI=1S/C8H6ClNO2/c9-7-4-12-8-2-10-5(3-11)1-6(7)8/h1-2,4,11H,3H2 |
| InChIKey | IDBPUUNCAKIIQG-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.59 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-chlorofuro[2,3-c]pyridin-5-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-chlorofuro[2,3-c]pyridin-5-yl)methanol?
The IUPAC name of (3-chlorofuro[2,3-c]pyridin-5-yl)methanol (CID 22047165) is (3-chlorofuro[2,3-c]pyridin-5-yl)methanol.
What is the SMILES notation for (3-chlorofuro[2,3-c]pyridin-5-yl)methanol?
The canonical SMILES for (3-chlorofuro[2,3-c]pyridin-5-yl)methanol is OCc1cc2c(Cl)coc2cn1.
What is the InChIKey of (3-chlorofuro[2,3-c]pyridin-5-yl)methanol?
The InChIKey is IDBPUUNCAKIIQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClNO2/c9-7-4-12-8-2-10-5(3-11)1-6(7)8/h1-2,4,11H,3H2.
What are the key properties of (3-chlorofuro[2,3-c]pyridin-5-yl)methanol?
(3-chlorofuro[2,3-c]pyridin-5-yl)methanol has a molecular weight of 183.59 g/mol, XLogP of 1.97, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-chlorofuro[2,3-c]pyridin-5-yl)methanol is sourced from PubChem (CID 22047165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).