About (3-methyl-2,3-dihydrofuro[2,3-c]pyridin-5-yl)methyl acetate
(3-methyl-2,3-dihydrofuro[2,3-c]pyridin-5-yl)methyl acetate (PubChem CID 22047300) has the molecular formula C11H13NO3
and a molecular weight of 207.23 g/mol. Its IUPAC name is (3-methyl-2,3-dihydrofuro[2,3-c]pyridin-5-yl)methyl acetate.
Molecular Properties
| Compound Name | (3-methyl-2,3-dihydrofuro[2,3-c]pyridin-5-yl)methyl acetate |
| PubChem CID | 22047300 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | (3-methyl-2,3-dihydrofuro[2,3-c]pyridin-5-yl)methyl acetate |
| SMILES | CC(=O)OCc1cc2c(cn1)OCC2C |
| InChI | InChI=1S/C11H13NO3/c1-7-5-15-11-4-12-9(3-10(7)11)6-14-8(2)13/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | PKUGOEKKIILFPA-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-methyl-2,3-dihydrofuro[2,3-c]pyridin-5-yl)methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-2,3-dihydrofuro[2,3-c]pyridin-5-yl)methyl acetate?
The IUPAC name of (3-methyl-2,3-dihydrofuro[2,3-c]pyridin-5-yl)methyl acetate (CID 22047300) is (3-methyl-2,3-dihydrofuro[2,3-c]pyridin-5-yl)methyl acetate.
What is the SMILES notation for (3-methyl-2,3-dihydrofuro[2,3-c]pyridin-5-yl)methyl acetate?
The canonical SMILES for (3-methyl-2,3-dihydrofuro[2,3-c]pyridin-5-yl)methyl acetate is CC(=O)OCc1cc2c(cn1)OCC2C.
What is the InChIKey of (3-methyl-2,3-dihydrofuro[2,3-c]pyridin-5-yl)methyl acetate?
The InChIKey is PKUGOEKKIILFPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO3/c1-7-5-15-11-4-12-9(3-10(7)11)6-14-8(2)13/h3-4,7H,5-6H2,1-2H3.
What are the key properties of (3-methyl-2,3-dihydrofuro[2,3-c]pyridin-5-yl)methyl acetate?
(3-methyl-2,3-dihydrofuro[2,3-c]pyridin-5-yl)methyl acetate has a molecular weight of 207.23 g/mol, XLogP of 1.64, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-2,3-dihydrofuro[2,3-c]pyridin-5-yl)methyl acetate is sourced from PubChem (CID 22047300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).