About 1-benzoyl-6,7-dimethoxyisoquinoline-4-carboxylic acid
1-benzoyl-6,7-dimethoxyisoquinoline-4-carboxylic acid (PubChem CID 22048357) has the molecular formula C19H15NO5
and a molecular weight of 337.33 g/mol. Its IUPAC name is 1-benzoyl-6,7-dimethoxyisoquinoline-4-carboxylic acid.
Molecular Properties
| Compound Name | 1-benzoyl-6,7-dimethoxyisoquinoline-4-carboxylic acid |
| PubChem CID | 22048357 |
| Molecular Formula | C19H15NO5 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 1-benzoyl-6,7-dimethoxyisoquinoline-4-carboxylic acid |
| SMILES | COc1cc2c(C(=O)O)cnc(C(=O)c3ccccc3)c2cc1OC |
| InChI | InChI=1S/C19H15NO5/c1-24-15-8-12-13(9-16(15)25-2)17(20-10-14(12)19(22)23)18(21)11-6-4-3-5-7-11/h3-10H,1-2H3,(H,22,23) |
| InChIKey | BPNJWGYAZGWPOV-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 85.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-benzoyl-6,7-dimethoxyisoquinoline-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzoyl-6,7-dimethoxyisoquinoline-4-carboxylic acid?
The IUPAC name of 1-benzoyl-6,7-dimethoxyisoquinoline-4-carboxylic acid (CID 22048357) is 1-benzoyl-6,7-dimethoxyisoquinoline-4-carboxylic acid.
What is the SMILES notation for 1-benzoyl-6,7-dimethoxyisoquinoline-4-carboxylic acid?
The canonical SMILES for 1-benzoyl-6,7-dimethoxyisoquinoline-4-carboxylic acid is COc1cc2c(C(=O)O)cnc(C(=O)c3ccccc3)c2cc1OC.
What is the InChIKey of 1-benzoyl-6,7-dimethoxyisoquinoline-4-carboxylic acid?
The InChIKey is BPNJWGYAZGWPOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15NO5/c1-24-15-8-12-13(9-16(15)25-2)17(20-10-14(12)19(22)23)18(21)11-6-4-3-5-7-11/h3-10H,1-2H3,(H,22,23).
What are the key properties of 1-benzoyl-6,7-dimethoxyisoquinoline-4-carboxylic acid?
1-benzoyl-6,7-dimethoxyisoquinoline-4-carboxylic acid has a molecular weight of 337.33 g/mol, XLogP of 3.18, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzoyl-6,7-dimethoxyisoquinoline-4-carboxylic acid is sourced from PubChem (CID 22048357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).