C21H31N3O2 — CID 22048564
2-(4-amino-2,3,5,6-tetramethylphenoxy)-N-methyl-N-(1-prop-2-ynylpiperidin-4-yl)acetamide (PubChem CID 22048564) has the molecular formula C21H31N3O2 and a molecular weight of 357.50 g/mol. Its IUPAC name is 2-(4-amino-2,3,5,6-tetramethylphenoxy)-N-methyl-N-(1-prop-2-ynylpiperidin-4-yl)acetamide.
| Compound Name | 2-(4-amino-2,3,5,6-tetramethylphenoxy)-N-methyl-N-(1-prop-2-ynylpiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 22048564 |
| Molecular Formula | C21H31N3O2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | 2-(4-amino-2,3,5,6-tetramethylphenoxy)-N-methyl-N-(1-prop-2-ynylpiperidin-4-yl)acetamide |
| SMILES | C#CCN1CCC(N(C)C(=O)COc2c(C)c(C)c(N)c(C)c2C)CC1 |
| InChI | InChI=1S/C21H31N3O2/c1-7-10-24-11-8-18(9-12-24)23(6)19(25)13-26-21-16(4)14(2)20(22)15(3)17(21)5/h1,18H,8-13,22H2,2-6H3 |
| InChIKey | BTXSQWIHWSHZFP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|