C29H37F2N3O3 — CID 22048765
N-[3-[1-[5-[4-(3,4-difluorophenyl)-2-oxo-1,3-oxazolidin-3-yl]pentyl]piperidin-4-yl]phenyl]-2-methylpropanamide (PubChem CID 22048765) has the molecular formula C29H37F2N3O3 and a molecular weight of 513.63 g/mol. Its IUPAC name is N-[3-[1-[5-[4-(3,4-difluorophenyl)-2-oxo-1,3-oxazolidin-3-yl]pentyl]piperidin-4-yl]phenyl]-2-methylpropanamide.
| Compound Name | N-[3-[1-[5-[4-(3,4-difluorophenyl)-2-oxo-1,3-oxazolidin-3-yl]pentyl]piperidin-4-yl]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 22048765 |
| Molecular Formula | C29H37F2N3O3 |
| Molecular Weight | 513.63 g/mol |
| Exact Mass | 513.28 |
| IUPAC Name | N-[3-[1-[5-[4-(3,4-difluorophenyl)-2-oxo-1,3-oxazolidin-3-yl]pentyl]piperidin-4-yl]phenyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1cccc(C2CCN(CCCCCN3C(=O)OCC3c3ccc(F)c(F)c3)CC2)c1 |
| InChI | InChI=1S/C29H37F2N3O3/c1-20(2)28(35)32-24-8-6-7-22(17-24)21-11-15-33(16-12-21)13-4-3-5-14-34-27(19-37-29(34)36)23-9-10-25(30)26(31)18-23/h6-10,17-18,20-21,27H,3-5,11-16,19H2,1-2H3,(H,32,35) |
| InChIKey | STPOQYKHTBGHHX-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.63 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|