About 6-(hydroxyamino)-3,4-dihydro-2H-pyridin-5-one
6-(hydroxyamino)-3,4-dihydro-2H-pyridin-5-one (PubChem CID 22049644) has the molecular formula C5H8N2O2
and a molecular weight of 128.13 g/mol. Its IUPAC name is 6-(hydroxyamino)-3,4-dihydro-2H-pyridin-5-one.
Molecular Properties
| Compound Name | 6-(hydroxyamino)-3,4-dihydro-2H-pyridin-5-one |
| PubChem CID | 22049644 |
| Molecular Formula | C5H8N2O2 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.06 |
| IUPAC Name | 6-(hydroxyamino)-3,4-dihydro-2H-pyridin-5-one |
| SMILES | O=C1CCCN=C1NO |
| InChI | InChI=1S/C5H8N2O2/c8-4-2-1-3-6-5(4)7-9/h9H,1-3H2,(H,6,7) |
| InChIKey | JGURVISMHYWWQC-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-(hydroxyamino)-3,4-dihydro-2H-pyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(hydroxyamino)-3,4-dihydro-2H-pyridin-5-one?
The IUPAC name of 6-(hydroxyamino)-3,4-dihydro-2H-pyridin-5-one (CID 22049644) is 6-(hydroxyamino)-3,4-dihydro-2H-pyridin-5-one.
What is the SMILES notation for 6-(hydroxyamino)-3,4-dihydro-2H-pyridin-5-one?
The canonical SMILES for 6-(hydroxyamino)-3,4-dihydro-2H-pyridin-5-one is O=C1CCCN=C1NO.
What is the InChIKey of 6-(hydroxyamino)-3,4-dihydro-2H-pyridin-5-one?
The InChIKey is JGURVISMHYWWQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O2/c8-4-2-1-3-6-5(4)7-9/h9H,1-3H2,(H,6,7).
What are the key properties of 6-(hydroxyamino)-3,4-dihydro-2H-pyridin-5-one?
6-(hydroxyamino)-3,4-dihydro-2H-pyridin-5-one has a molecular weight of 128.13 g/mol, XLogP of -0.27, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(hydroxyamino)-3,4-dihydro-2H-pyridin-5-one is sourced from PubChem (CID 22049644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).