About ethyl 2-fluoro-5-[2-[4-(trifluoromethyl)-3-pyridinyl]-1,3-thiazol-4-yl]benzoate
ethyl 2-fluoro-5-[2-[4-(trifluoromethyl)-3-pyridinyl]-1,3-thiazol-4-yl]benzoate (PubChem CID 22049705) has the molecular formula C18H12F4N2O2S
and a molecular weight of 396.37 g/mol. Its IUPAC name is ethyl 2-fluoro-5-[2-[4-(trifluoromethyl)-3-pyridinyl]-1,3-thiazol-4-yl]benzoate.
Molecular Properties
| Compound Name | ethyl 2-fluoro-5-[2-[4-(trifluoromethyl)-3-pyridinyl]-1,3-thiazol-4-yl]benzoate |
| PubChem CID | 22049705 |
| Molecular Formula | C18H12F4N2O2S |
| Molecular Weight | 396.37 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | ethyl 2-fluoro-5-[2-[4-(trifluoromethyl)-3-pyridinyl]-1,3-thiazol-4-yl]benzoate |
| SMILES | CCOC(=O)c1cc(-c2csc(-c3cnccc3C(F)(F)F)n2)ccc1F |
| InChI | InChI=1S/C18H12F4N2O2S/c1-2-26-17(25)11-7-10(3-4-14(11)19)15-9-27-16(24-15)12-8-23-6-5-13(12)18(20,21)22/h3-9H,2H2,1H3 |
| InChIKey | NHZOLNDBPMITAI-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.37 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-fluoro-5-[2-[4-(trifluoromethyl)-3-pyridinyl]-1,3-thiazol-4-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-fluoro-5-[2-[4-(trifluoromethyl)-3-pyridinyl]-1,3-thiazol-4-yl]benzoate?
The IUPAC name of ethyl 2-fluoro-5-[2-[4-(trifluoromethyl)-3-pyridinyl]-1,3-thiazol-4-yl]benzoate (CID 22049705) is ethyl 2-fluoro-5-[2-[4-(trifluoromethyl)-3-pyridinyl]-1,3-thiazol-4-yl]benzoate.
What is the SMILES notation for ethyl 2-fluoro-5-[2-[4-(trifluoromethyl)-3-pyridinyl]-1,3-thiazol-4-yl]benzoate?
The canonical SMILES for ethyl 2-fluoro-5-[2-[4-(trifluoromethyl)-3-pyridinyl]-1,3-thiazol-4-yl]benzoate is CCOC(=O)c1cc(-c2csc(-c3cnccc3C(F)(F)F)n2)ccc1F.
What is the InChIKey of ethyl 2-fluoro-5-[2-[4-(trifluoromethyl)-3-pyridinyl]-1,3-thiazol-4-yl]benzoate?
The InChIKey is NHZOLNDBPMITAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12F4N2O2S/c1-2-26-17(25)11-7-10(3-4-14(11)19)15-9-27-16(24-15)12-8-23-6-5-13(12)18(20,21)22/h3-9H,2H2,1H3.
What are the key properties of ethyl 2-fluoro-5-[2-[4-(trifluoromethyl)-3-pyridinyl]-1,3-thiazol-4-yl]benzoate?
ethyl 2-fluoro-5-[2-[4-(trifluoromethyl)-3-pyridinyl]-1,3-thiazol-4-yl]benzoate has a molecular weight of 396.37 g/mol, XLogP of 5.21, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-fluoro-5-[2-[4-(trifluoromethyl)-3-pyridinyl]-1,3-thiazol-4-yl]benzoate is sourced from PubChem (CID 22049705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).