About methyl 5-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]furan-2-carboxylate
methyl 5-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]furan-2-carboxylate (PubChem CID 22049896) has the molecular formula C19H14BrF2NO5
and a molecular weight of 454.22 g/mol. Its IUPAC name is methyl 5-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]furan-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]furan-2-carboxylate |
| PubChem CID | 22049896 |
| Molecular Formula | C19H14BrF2NO5 |
| Molecular Weight | 454.22 g/mol |
| Exact Mass | 453.00 |
| IUPAC Name | methyl 5-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(-n2c(C)cc(OCc3ccc(F)cc3F)c(Br)c2=O)o1 |
| InChI | InChI=1S/C19H14BrF2NO5/c1-10-7-15(27-9-11-3-4-12(21)8-13(11)22)17(20)18(24)23(10)16-6-5-14(28-16)19(25)26-2/h3-8H,9H2,1-2H3 |
| InChIKey | PBVWDJDRFPHUMF-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 70.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 454.22 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 5-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]furan-2-carboxylate?
The IUPAC name of methyl 5-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]furan-2-carboxylate (CID 22049896) is methyl 5-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]furan-2-carboxylate.
What is the SMILES notation for methyl 5-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]furan-2-carboxylate?
The canonical SMILES for methyl 5-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]furan-2-carboxylate is COC(=O)c1ccc(-n2c(C)cc(OCc3ccc(F)cc3F)c(Br)c2=O)o1.
What is the InChIKey of methyl 5-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]furan-2-carboxylate?
The InChIKey is PBVWDJDRFPHUMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14BrF2NO5/c1-10-7-15(27-9-11-3-4-12(21)8-13(11)22)17(20)18(24)23(10)16-6-5-14(28-16)19(25)26-2/h3-8H,9H2,1-2H3.
What are the key properties of methyl 5-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]furan-2-carboxylate?
methyl 5-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]furan-2-carboxylate has a molecular weight of 454.22 g/mol, XLogP of 4.15, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]furan-2-carboxylate is sourced from PubChem (CID 22049896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).