About 5-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]furan-2-carboxamide
5-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]furan-2-carboxamide (PubChem CID 22049901) has the molecular formula C18H13BrF2N2O4
and a molecular weight of 439.21 g/mol. Its IUPAC name is 5-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]furan-2-carboxamide.
Molecular Properties
| Compound Name | 5-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]furan-2-carboxamide |
| PubChem CID | 22049901 |
| Molecular Formula | C18H13BrF2N2O4 |
| Molecular Weight | 439.21 g/mol |
| Exact Mass | 438.00 |
| IUPAC Name | 5-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]furan-2-carboxamide |
| SMILES | Cc1cc(OCc2ccc(F)cc2F)c(Br)c(=O)n1-c1ccc(C(N)=O)o1 |
| InChI | InChI=1S/C18H13BrF2N2O4/c1-9-6-14(26-8-10-2-3-11(20)7-12(10)21)16(19)18(25)23(9)15-5-4-13(27-15)17(22)24/h2-7H,8H2,1H3,(H2,22,24) |
| InChIKey | RSNPZHIWCLHFHM-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 439.21 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]furan-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]furan-2-carboxamide?
The IUPAC name of 5-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]furan-2-carboxamide (CID 22049901) is 5-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]furan-2-carboxamide.
What is the SMILES notation for 5-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]furan-2-carboxamide?
The canonical SMILES for 5-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]furan-2-carboxamide is Cc1cc(OCc2ccc(F)cc2F)c(Br)c(=O)n1-c1ccc(C(N)=O)o1.
What is the InChIKey of 5-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]furan-2-carboxamide?
The InChIKey is RSNPZHIWCLHFHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13BrF2N2O4/c1-9-6-14(26-8-10-2-3-11(20)7-12(10)21)16(19)18(25)23(9)15-5-4-13(27-15)17(22)24/h2-7H,8H2,1H3,(H2,22,24).
What are the key properties of 5-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]furan-2-carboxamide?
5-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]furan-2-carboxamide has a molecular weight of 439.21 g/mol, XLogP of 3.46, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]furan-2-carboxamide is sourced from PubChem (CID 22049901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).