About 5-[[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]methyl]furan-2-carboxylic acid
5-[[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]methyl]furan-2-carboxylic acid (PubChem CID 22050159) has the molecular formula C19H14BrF2NO5
and a molecular weight of 454.22 g/mol. Its IUPAC name is 5-[[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]methyl]furan-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-[[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]methyl]furan-2-carboxylic acid |
| PubChem CID | 22050159 |
| Molecular Formula | C19H14BrF2NO5 |
| Molecular Weight | 454.22 g/mol |
| Exact Mass | 453.00 |
| IUPAC Name | 5-[[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]methyl]furan-2-carboxylic acid |
| SMILES | Cc1cc(OCc2ccc(F)cc2F)c(Br)c(=O)n1Cc1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C19H14BrF2NO5/c1-10-6-16(27-9-11-2-3-12(21)7-14(11)22)17(20)18(24)23(10)8-13-4-5-15(28-13)19(25)26/h2-7H,8-9H2,1H3,(H,25,26) |
| InChIKey | TVNSZHFZZWWSNU-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 454.22 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]methyl]furan-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]methyl]furan-2-carboxylic acid?
The IUPAC name of 5-[[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]methyl]furan-2-carboxylic acid (CID 22050159) is 5-[[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]methyl]furan-2-carboxylic acid.
What is the SMILES notation for 5-[[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]methyl]furan-2-carboxylic acid?
The canonical SMILES for 5-[[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]methyl]furan-2-carboxylic acid is Cc1cc(OCc2ccc(F)cc2F)c(Br)c(=O)n1Cc1ccc(C(=O)O)o1.
What is the InChIKey of 5-[[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]methyl]furan-2-carboxylic acid?
The InChIKey is TVNSZHFZZWWSNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14BrF2NO5/c1-10-6-16(27-9-11-2-3-12(21)7-14(11)22)17(20)18(24)23(10)8-13-4-5-15(28-13)19(25)26/h2-7H,8-9H2,1H3,(H,25,26).
What are the key properties of 5-[[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]methyl]furan-2-carboxylic acid?
5-[[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]methyl]furan-2-carboxylic acid has a molecular weight of 454.22 g/mol, XLogP of 4.12, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[3-bromo-4-[(2,4-difluorophenyl)methoxy]-6-methyl-2-oxo-1-pyridinyl]methyl]furan-2-carboxylic acid is sourced from PubChem (CID 22050159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).