C22H27ClN3O2S+ — CID 2205020
2-[2-chloro-4-(4-methylpiperazin-4-ium-1-carbothioyl)phenoxy]-N-(2,4-dimethylphenyl)acetamide (PubChem CID 2205020) has the molecular formula C22H27ClN3O2S+ and a molecular weight of 433.00 g/mol. Its IUPAC name is 2-[2-chloro-4-(4-methylpiperazin-4-ium-1-carbothioyl)phenoxy]-N-(2,4-dimethylphenyl)acetamide.
| Compound Name | 2-[2-chloro-4-(4-methylpiperazin-4-ium-1-carbothioyl)phenoxy]-N-(2,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 2205020 |
| Molecular Formula | C22H27ClN3O2S+ |
| Molecular Weight | 433.00 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 2-[2-chloro-4-(4-methylpiperazin-4-ium-1-carbothioyl)phenoxy]-N-(2,4-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)COc2ccc(C(=S)N3CC[NH+](C)CC3)cc2Cl)c(C)c1 |
| InChI | InChI=1S/C22H26ClN3O2S/c1-15-4-6-19(16(2)12-15)24-21(27)14-28-20-7-5-17(13-18(20)23)22(29)26-10-8-25(3)9-11-26/h4-7,12-13H,8-11,14H2,1-3H3,(H,24,27)/p+1 |
| InChIKey | RXKCYYRIHYUBJW-UHFFFAOYSA-O |
| XLogP | 2.48 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.00 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|