C20H15F4NO2 — CID 22050442
1-[(3-fluorophenyl)methyl]-4-phenylmethoxy-3-(trifluoromethyl)pyridin-2-one (PubChem CID 22050442) has the molecular formula C20H15F4NO2 and a molecular weight of 377.34 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]-4-phenylmethoxy-3-(trifluoromethyl)pyridin-2-one.
| Compound Name | 1-[(3-fluorophenyl)methyl]-4-phenylmethoxy-3-(trifluoromethyl)pyridin-2-one |
|---|---|
| PubChem CID | 22050442 |
| Molecular Formula | C20H15F4NO2 |
| Molecular Weight | 377.34 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]-4-phenylmethoxy-3-(trifluoromethyl)pyridin-2-one |
| SMILES | O=c1c(C(F)(F)F)c(OCc2ccccc2)ccn1Cc1cccc(F)c1 |
| InChI | InChI=1S/C20H15F4NO2/c21-16-8-4-7-15(11-16)12-25-10-9-17(18(19(25)26)20(22,23)24)27-13-14-5-2-1-3-6-14/h1-11H,12-13H2 |
| InChIKey | QYYSKRXDEFAZEW-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.34 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |