C27H22N2O3 — CID 22051484
1-naphthalen-2-yl-5-oxo-N-(4-phenoxyphenyl)pyrrolidine-3-carboxamide (PubChem CID 22051484) has the molecular formula C27H22N2O3 and a molecular weight of 422.48 g/mol. Its IUPAC name is 1-naphthalen-2-yl-5-oxo-N-(4-phenoxyphenyl)pyrrolidine-3-carboxamide.
| Compound Name | 1-naphthalen-2-yl-5-oxo-N-(4-phenoxyphenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 22051484 |
| Molecular Formula | C27H22N2O3 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 1-naphthalen-2-yl-5-oxo-N-(4-phenoxyphenyl)pyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Oc2ccccc2)cc1)C1CC(=O)N(c2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C27H22N2O3/c30-26-17-21(18-29(26)23-13-10-19-6-4-5-7-20(19)16-23)27(31)28-22-11-14-25(15-12-22)32-24-8-2-1-3-9-24/h1-16,21H,17-18H2,(H,28,31) |
| InChIKey | UNLLULRGZKDAEF-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |